CAS 89615-73-6
:(R)-2-acetamido-3-(4-nitrophenyl)propanoic acid
Description:
(R)-2-acetamido-3-(4-nitrophenyl)propanoic acid, with the CAS number 89615-73-6, is an amino acid derivative characterized by the presence of an acetamido group and a nitrophenyl substituent. This compound features a chiral center, which contributes to its stereochemistry, specifically the (R) configuration. It is a white to off-white solid that is soluble in polar solvents, such as water and methanol, due to the presence of both acidic and basic functional groups. The nitrophenyl group enhances its electronic properties, potentially making it useful in various chemical applications, including as a building block in pharmaceuticals or as a probe in biochemical assays. The compound's acidity is attributed to the carboxylic acid functional group, while the acetamido group can participate in hydrogen bonding, influencing its reactivity and interactions with biological systems. Overall, this compound's unique structure and functional groups make it of interest in medicinal chemistry and related fields.
Formula:C11H12N2O5
InChI:InChI=1/C11H12N2O5/c1-7(14)12-10(11(15)16)6-8-2-4-9(5-3-8)13(17)18/h2-5,10H,6H2,1H3,(H,12,14)(H,15,16)/t10-/m1/s1
SMILES:CC(=N[C@H](Cc1ccc(cc1)N(=O)=O)C(=O)O)O
Synonyms:- D-phenylalanine, N-acetyl-4-nitro-
- N-Acetyl-4-nitro-D-phenylalanine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
