CAS 896160-35-3

2-Chloro-5-[[3-(trifluoromethyl)benzoyl]amino]benzoic acid

Description:

2-Chloro-5-[[3-(trifluoromethyl)benzoyl]amino]benzoic acid, with the CAS number 896160-35-3, is a chemical compound characterized by its complex structure, which includes a chloro substituent and a trifluoromethyl group attached to a benzoyl moiety. This compound is typically classified as an aromatic carboxylic acid due to the presence of the carboxylic acid functional group (-COOH) in its structure. The presence of the chloro and trifluoromethyl groups contributes to its unique chemical properties, such as increased lipophilicity and potential biological activity. It may exhibit significant interactions in biological systems, making it of interest in pharmaceutical research. The compound is likely to be solid at room temperature and may have moderate solubility in organic solvents. Its reactivity can be influenced by the electron-withdrawing nature of the trifluoromethyl group, which can affect its acidity and reactivity in various chemical reactions. Overall, this compound's specific characteristics make it a subject of interest in synthetic organic chemistry and medicinal chemistry.

Formula: C₁₅H₉ClF₃NO₃

InChI: InChI=1/C15H9ClF3NO3/c16-12-5-4-10(7-11(12)14(22)23)20-13(21)8-2-1-3-9(6-8)15(17,18)19/h1-7H,(H,20,21)(H,22,23)

InChI key: InChIKey=LZOJLNTZKLHBJS-UHFFFAOYSA-N

SMILES: N(C(=O)C1=CC(C(F)(F)F)=CC=C1)C2=CC(C(O)=O)=C(Cl)C=C2

Synonyms:

• 2-Chloro-5-(3-(Trifluoromethyl)Benzamido)Benzoic Acid
• 5-[3-(Trifluoromethyl)Benzoylamino]-2-Chlorobenzoic Acid
• 5-[[[3-(Trifluoromethyl)phenyl]carbonyl]amino]-2-chlorobenzoic acid
• Benzoic acid, 2-chloro-5-[[3-(trifluoromethyl)benzoyl]amino]-
• 2-Chloro-5-[[3-(trifluoromethyl)benzoyl]amino]benzoic acid
• 2-Chloro-5-{[3-(trifluoromethyl)benzoyl]amino}benzoic acid

2-Chloro-5-[[3-(trifluoromethyl)benzoyl]amino]benzoic acid

CAS: 896160-35-3

Formula: C₁₅H₉ClF₃NO₃

Molecular weight: 343.6851

Ref: IN-DA003X0O