
CAS 896160-78-4
:5-Amino-N-methyl-3-pyridinecarboxamide
Description:
5-Amino-N-methyl-3-pyridinecarboxamide, with the CAS number 896160-78-4, is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features an amino group (-NH2) and a methyl group (-CH3) attached to the nitrogen of the carboxamide functional group, contributing to its reactivity and solubility in polar solvents. The presence of the carboxamide group indicates that it can participate in hydrogen bonding, enhancing its potential as a ligand in coordination chemistry or as a building block in pharmaceutical synthesis. The compound's molecular structure suggests it may exhibit biological activity, potentially interacting with various biological targets. Its properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the sample. Overall, 5-Amino-N-methyl-3-pyridinecarboxamide is of interest in medicinal chemistry and may serve as a precursor for the synthesis of more complex molecules.
Formula:C7H9N3O
InChI:InChI=1S/C7H9N3O/c1-9-7(11)5-2-6(8)4-10-3-5/h2-4H,8H2,1H3,(H,9,11)
InChI key:InChIKey=CSAYTNKUIPQFJF-UHFFFAOYSA-N
SMILES:C(NC)(=O)C=1C=C(N)C=NC1
Synonyms:- 3-Pyridinecarboxamide, 5-amino-N-methyl-
- 5-Amino-N-methyl-3-pyridinecarboxamide
- 5-Amino-N-methylnicotinamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.