CAS 896161-00-5

5-Amino-N,N-dimethyl-3-pyridinesulfonamide

Description:

5-Amino-N,N-dimethyl-3-pyridinesulfonamide is a chemical compound characterized by its pyridine ring structure, which is substituted with an amino group and a sulfonamide functional group. This compound typically exhibits properties associated with sulfonamides, such as antibacterial activity, due to the presence of the sulfonamide moiety. The dimethyl groups attached to the nitrogen atom contribute to its lipophilicity, potentially enhancing its ability to penetrate biological membranes. The amino group can participate in hydrogen bonding, influencing its solubility and reactivity. This compound may be utilized in various applications, including medicinal chemistry, where it could serve as a lead compound for the development of new pharmaceuticals. Its specific interactions with biological targets would depend on its structural conformation and the presence of functional groups, making it a subject of interest in drug design and development. As with many sulfonamides, it is important to consider its potential side effects and mechanisms of action in biological systems.

Formula: C₇H₁₁N₃O₂S

InChI: InChI=1S/C7H11N3O2S/c1-10(2)13(11,12)7-3-6(8)4-9-5-7/h3-5H,8H2,1-2H3

InChI key: InChIKey=YHTQQQUSVZOTGP-UHFFFAOYSA-N

SMILES: S(N(C)C)(=O)(=O)C=1C=C(N)C=NC1

Synonyms:

• 3-Pyridinesulfonamide, 5-amino-N,N-dimethyl-
• 5-Amino-N,N-dimethylpyridine-3-sulfonamide
• 5-Amino-N,N-dimethyl-3-pyridinesulfonamide