CAS 896161-10-7

N-(5-Amino-3-chloro-2-pyridinyl)acetamide

Description:

N-(5-Amino-3-chloro-2-pyridinyl)acetamide is a chemical compound characterized by its pyridine ring structure, which includes an amino group and a chloro substituent. This compound features an acetamide functional group, contributing to its potential as a pharmaceutical intermediate or active ingredient. The presence of the amino group suggests that it may participate in hydrogen bonding, enhancing its solubility in polar solvents. The chloro substituent can influence the compound's reactivity and biological activity, potentially affecting its interaction with biological targets. This compound may exhibit properties such as antimicrobial or anti-inflammatory activities, making it of interest in medicinal chemistry. Its molecular structure allows for various synthetic modifications, which can lead to derivatives with enhanced efficacy or reduced toxicity. As with many chemical substances, safety data should be consulted to understand its handling, storage, and potential hazards. Overall, N-(5-Amino-3-chloro-2-pyridinyl)acetamide represents a versatile compound with applications in research and development within the pharmaceutical industry.

Formula: C₇H₈ClN₃O

InChI: InChI=1S/C7H8ClN3O/c1-4(12)11-7-6(8)2-5(9)3-10-7/h2-3H,9H2,1H3,(H,10,11,12)

InChI key: InChIKey=LVRGHWLWFICJNJ-UHFFFAOYSA-N

SMILES: N(C(C)=O)C1=C(Cl)C=C(N)C=N1

Synonyms:

• Acetamide, N-(5-amino-3-chloro-2-pyridinyl)-
• N-(5-Amino-3-chloro-2-pyridinyl)acetamide
• N-(5-Amino-3-chloropyridin-2-yl)acetamide