
CAS 89622-82-2
:1,5-Bis(1,1-dimethylethyl) 3-hydroxy-3-methylpentanedioate
Description:
1,5-Bis(1,1-dimethylethyl) 3-hydroxy-3-methylpentanedioate, with the CAS number 89622-82-2, is an organic compound characterized by its complex structure, which includes multiple functional groups. This substance features two tert-butyl groups, which contribute to its hydrophobic nature and steric bulk, making it less reactive in certain chemical environments. The presence of a hydroxyl group indicates potential for hydrogen bonding, which can influence its solubility and reactivity. Additionally, the pentanedioate moiety suggests that it may participate in esterification or other reactions typical of carboxylic acid derivatives. This compound is likely to be used in various applications, including as an intermediate in organic synthesis or as a stabilizer in polymer formulations due to its bulky structure. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the sample. Overall, the unique combination of functional groups and structural features makes it an interesting compound for further study in organic chemistry.
Formula:C14H26O5
InChI:InChI=1S/C14H26O5/c1-12(2,3)18-10(15)8-14(7,17)9-11(16)19-13(4,5)6/h17H,8-9H2,1-7H3
InChI key:InChIKey=FRKFWGBYXMXJOZ-UHFFFAOYSA-N
SMILES:C(C(CC(OC(C)(C)C)=O)(C)O)C(OC(C)(C)C)=O
Synonyms:- Pentanedioic acid, 3-hydroxy-3-methyl-, 1,5-bis(1,1-dimethylethyl) ester
- Pentanedioic acid, 3-hydroxy-3-methyl-, bis(1,1-dimethylethyl) ester
- 1,5-Bis(1,1-dimethylethyl) 3-hydroxy-3-methylpentanedioate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Pentanedioic acid, 3-hydroxy-3-methyl-, bis(1,1-dimethylethyl) ester
CAS:Formula:C14H26O5Molecular weight:274.3532
