
CAS 89630-70-6
:3-Chlorodihydro-3,5-dimethyl-5-phenyl-2(3H)-furanone
Description:
3-Chlorodihydro-3,5-dimethyl-5-phenyl-2(3H)-furanone, with the CAS number 89630-70-6, is an organic compound characterized by its furanone structure, which features a five-membered lactone ring. This compound contains a chlorine atom and multiple methyl and phenyl substituents, contributing to its unique chemical properties. The presence of the chlorine atom typically enhances the compound's reactivity, making it useful in various synthetic applications. The dimethyl and phenyl groups can influence the compound's physical properties, such as solubility and boiling point, as well as its potential biological activity. Generally, compounds of this type may exhibit interesting flavors or fragrances, as furanones are often associated with sweet and fruity aromas. Additionally, the structural complexity may allow for diverse reactivity patterns, making it a candidate for further chemical transformations in organic synthesis. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C12H13ClO2
InChI:InChI=1S/C12H13ClO2/c1-11(13)8-12(2,15-10(11)14)9-6-4-3-5-7-9/h3-7H,8H2,1-2H3
InChI key:InChIKey=AIOSGNIKZIVZJX-UHFFFAOYSA-N
SMILES:CC1(CC(C)(Cl)C(=O)O1)C2=CC=CC=C2
Synonyms:- 3-Chloro-3,5-dimethyl-5-phenyloxolan-2-one
- 3-Chlorodihydro-3,5-dimethyl-5-phenyl-2(3H)-furanone
- 2(3H)-Furanone, 3-chlorodihydro-3,5-dimethyl-5-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2(3H)-Furanone,3-chlorodihydro-3,5-dimethyl-5-phenyl-
CAS:Formula:C12H13ClO2Molecular weight:224.6834
