CAS 89632-04-2
:N1,N1,N2,N2-Tetraethyl-1,2-octanediamine
Description:
N1,N1,N2,N2-Tetraethyl-1,2-octanediamine is an organic compound characterized by its structure, which features a long carbon chain with two amine functional groups. This compound belongs to the class of diamines, specifically having ethyl groups attached to both nitrogen atoms, which enhances its solubility in organic solvents. It typically appears as a colorless to pale yellow liquid and has a relatively low volatility. The presence of multiple ethyl groups contributes to its hydrophobic nature, making it less soluble in water. This compound is often utilized in various chemical applications, including as a building block in the synthesis of polymers and surfactants. Its amine groups can participate in various chemical reactions, such as nucleophilic substitutions and complexation with metal ions. Safety considerations are important when handling this compound, as it may pose health risks if inhaled or ingested, and appropriate protective measures should be taken. Overall, N1,N1,N2,N2-Tetraethyl-1,2-octanediamine is a versatile chemical with significant industrial relevance.
Formula:C16H36N2
InChI:InChI=1S/C16H36N2/c1-6-11-12-13-14-16(18(9-4)10-5)15-17(7-2)8-3/h16H,6-15H2,1-5H3
InChI key:InChIKey=KCMJRUUPADQQMS-UHFFFAOYSA-N
SMILES:C(N(CC)CC)(CN(CC)CC)CCCCCC
Synonyms:- 1,2-Octanediamine, N1,N1,N2,N2-tetraethyl-
- N1,N1,N2,N2-Tetraethyl-1,2-octanediamine
- 1,2-Octanediamine, N,N,N′,N′-tetraethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
