CAS 89634-75-3

1-Chloro-4-fluoro-2-(trifluoromethyl)benzene

Description:

1-Chloro-4-fluoro-2-(trifluoromethyl)benzene, with the CAS number 89634-75-3, is an aromatic compound characterized by the presence of a chloro group, a fluoro group, and a trifluoromethyl group attached to a benzene ring. This compound exhibits a high degree of fluorination, which typically enhances its chemical stability and lipophilicity. The presence of multiple electronegative halogen atoms influences its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. The trifluoromethyl group is known for imparting unique electronic properties, often increasing the compound's potency in biological systems. Additionally, the compound's physical properties, such as boiling point and solubility, are influenced by the halogen substituents, which can affect its behavior in different solvents. Due to its structural characteristics, 1-chloro-4-fluoro-2-(trifluoromethyl)benzene may find applications in pharmaceuticals, agrochemicals, and materials science, particularly in the development of fluorinated compounds with specific functional properties.

Formula: C₇H₃ClF₄

InChI: InChI=1S/C7H3ClF4/c8-6-2-1-4(9)3-5(6)7(10,11)12/h1-3H

InChI key: InChIKey=CBMMVERXHJUMCM-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=C(Cl)C=CC(F)=C1

Synonyms:

• 1-Chloro-4-fluoro-2-(trifluoromethyl)benzene
• Benzene, 1-chloro-4-fluoro-2-(trifluoromethyl)-

2-Chloro-5-fluorobenzotrifluoride

CAS: 89634-75-3

Formula: C₇H₃ClF₄

Purity: 97%

Color and Shape: Liquid

Molecular weight: 198.5453

Ref: IN-DA003W8Y

2-Chloro-5-fluorobenzotrifluoride

CAS: 89634-75-3

2-Chloro-5-fluorobenzotrifluoride

Formula: C₇H₃ClF₄

Purity: 95%

Color and Shape: Liquid

Molecular weight: 198.55g/mol

Ref: 54-PC9088

2-Chloro-5-fluorobenzotrifluoride

CAS: 89634-75-3

Formula: C₇H₃ClF₄

Purity: 98%

Color and Shape: Liquid

Molecular weight: 198.54

Ref: 10-F062703