CymitQuimica logo

CAS 89634-76-4

:

1-Chloro-2-fluoro-4-nitro-5-(trifluoromethyl)benzene

Description:
1-Chloro-2-fluoro-4-nitro-5-(trifluoromethyl)benzene, with the CAS number 89634-76-4, is an aromatic compound characterized by the presence of multiple halogen and nitro functional groups. This compound features a benzene ring substituted with a chlorine atom, a fluorine atom, a nitro group, and a trifluoromethyl group, which significantly influence its chemical properties and reactivity. The presence of the nitro group typically imparts electron-withdrawing characteristics, affecting the compound's electrophilicity and nucleophilicity. The trifluoromethyl group enhances the lipophilicity and stability of the molecule, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. Additionally, the chlorine and fluorine substituents can contribute to the compound's overall polarity and solubility in organic solvents. Due to its complex structure, this compound may exhibit unique physical properties such as boiling and melting points, which are influenced by the interactions between the substituents and the benzene ring. Safety and handling precautions are essential due to the potential toxicity associated with halogenated compounds.
Formula:C7H2ClF4NO2
InChI:InChI=1S/C7H2ClF4NO2/c8-4-1-3(7(10,11)12)6(13(14)15)2-5(4)9/h1-2H
InChI key:InChIKey=BNRUORLMVKXHTL-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(C(F)(F)F)C=C(Cl)C(F)=C1
Synonyms:
  • Benzene, 1-chloro-2-fluoro-4-nitro-5-(trifluoromethyl)-
  • 1-Chloro-2-fluoro-4-nitro-5-(trifluoromethyl)benzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.