
CAS 89636-94-2
:14-(2,4-Dichloro-5-methylphenoxy)-3,6,9,12-tetraoxatetradecan-1-ol
Description:
14-(2,4-Dichloro-5-methylphenoxy)-3,6,9,12-tetraoxatetradecan-1-ol, with the CAS number 89636-94-2, is a synthetic chemical compound characterized by its complex structure, which includes a long carbon chain and multiple ether linkages. The presence of the 2,4-dichloro-5-methylphenoxy group indicates that it has a phenolic moiety, contributing to its potential biological activity and hydrophobic characteristics. The tetraoxatetradecan structure suggests that it contains four ether (–O–) linkages, which can enhance solubility in polar solvents and influence its interaction with biological membranes. This compound may exhibit surfactant properties due to its amphiphilic nature, making it useful in various applications, including pharmaceuticals, agrochemicals, or as a surfactant in formulations. Its stability, reactivity, and specific applications would depend on the conditions under which it is used, including pH, temperature, and the presence of other chemical species. As with many synthetic compounds, safety and handling precautions are essential due to potential toxicity or environmental impact.
Formula:C17H26Cl2O6
InChI:InChI=1S/C17H26Cl2O6/c1-14-12-17(16(19)13-15(14)18)25-11-10-24-9-8-23-7-6-22-5-4-21-3-2-20/h12-13,20H,2-11H2,1H3
InChI key:InChIKey=YVLPQTXZSBBSHF-UHFFFAOYSA-N
SMILES:O(CCOCCOCCOCCOCCO)C1=C(Cl)C=C(Cl)C(C)=C1
Synonyms:- 14-[(4,6-Dichloro-m-tolyl)oxy]-3,6,9,12-tetraoxatetradecan-1-ol
- 3,6,9,12-Tetraoxatetradecan-1-ol, 14-[(4,6-dichloro-m-tolyl)oxy]-
- 3,6,9,12-Tetraoxatetradecan-1-ol, 14-(2,4-dichloro-5-methylphenoxy)-
- 14-(2,4-Dichloro-5-methylphenoxy)-3,6,9,12-tetraoxatetradecan-1-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3,6,9,12-Tetraoxatetradecan-1-ol,14-(2,4-dichloro-5-methylphenoxy)-
CAS:Formula:C17H26Cl2O6Molecular weight:397.29074
