CAS 89639-74-7
:3,4-dimethylthiophene-2-carboxylic acid
Description:
3,4-Dimethylthiophene-2-carboxylic acid is an organic compound characterized by its thiophene ring structure, which is a five-membered aromatic ring containing sulfur. The presence of two methyl groups at the 3 and 4 positions of the thiophene ring contributes to its unique properties, including increased hydrophobicity and potential for various chemical reactivity. The carboxylic acid functional group at the 2 position introduces acidity and enhances the compound's solubility in polar solvents. This compound is typically a solid at room temperature and may exhibit a characteristic odor associated with thiophene derivatives. Its applications may include use in organic synthesis, as a building block in pharmaceuticals, or in the development of agrochemicals. Additionally, the presence of both the methyl and carboxylic acid groups can influence its reactivity, making it a versatile intermediate in various chemical reactions. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C7H8O2S
InChI:InChI=1/C7H8O2S/c1-4-3-10-6(5(4)2)7(8)9/h3H,1-2H3,(H,8,9)
SMILES:Cc1csc(c1C)C(=O)O
Synonyms:- 2-Thiophenecarboxylic Acid, 3,4-Dimethyl-
- 3,4-Dimethylthiophene-2-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3,4-dimethylthiophene-2-carboxylic acid
CAS:Formula:C7H8O2SPurity:97%Color and Shape:SolidMolecular weight:156.20223,4-Dimethylthiophene-2-carboxylic acid
CAS:3,4-Dimethylthiophene-2-carboxylic acidPurity:97%Molecular weight:156.20g/mol3,4-Dimethylthiophene-2-carboxylic acid
CAS:Formula:C7H8O2SPurity:97%Color and Shape:No data available.Molecular weight:156.23,4-Dimethylthiophene-2-carboxylic acid
CAS:3,4-Dimethylthiophene-2-carboxylic acid is an experimental compound that has been shown to be a linear molecule with a molecular weight of 144. The experimental equation for the formation of 3,4-dimethylthiophene-2-carboxylic acid from 3,4-dimethoxythiophene and acetic acid is:Formula:C7H8O2SPurity:Min. 95%Molecular weight:156.2 g/mol



