CAS 89639-83-8

4,5-dimethylfuran-2-carboxylic acid

Description:

4,5-Dimethylfuran-2-carboxylic acid is an organic compound characterized by its furan ring structure, which is a five-membered aromatic ring containing oxygen. This compound features two methyl groups attached to the furan ring at the 4 and 5 positions, and a carboxylic acid functional group at the 2 position. Its molecular formula typically includes carbon, hydrogen, and oxygen atoms, reflecting its structure. The presence of the carboxylic acid group imparts acidic properties, making it capable of participating in various chemical reactions, such as esterification and decarboxylation. This compound is of interest in organic synthesis and may have applications in pharmaceuticals or as an intermediate in the production of other chemical substances. Additionally, its unique structure may contribute to specific physical properties, such as solubility in polar solvents and potential reactivity with nucleophiles. Overall, 4,5-dimethylfuran-2-carboxylic acid exemplifies the diverse chemistry associated with furan derivatives.

Formula: C₇H₈O₃

InChI: InChI=1/C7H8O3/c1-4-3-6(7(8)9)10-5(4)2/h3H,1-2H3,(H,8,9)

InChI key: BNVXYXRSJIWWDX-UHFFFAOYSA-N

SMILES: Cc1cc(C(=O)O)oc1C

Synonyms:

• 2-Furancarboxylic Acid, 4,5-Dimethyl-
• 4,5-Dimethyl-2-Furoic Acid

2-Furancarboxylic acid, 4,5-dimethyl-

CAS: 89639-83-8

Formula: C₇H₈O₃

Purity: %

Color and Shape: Solid

Molecular weight: 140.1366

Ref: IN-DA003W87

4,5-dimethyl-2-furoic acid

CAS: 89639-83-8

4,5-dimethyl-2-furoic acid

Formula: C₇H₈O₃

Purity: ≥95%

Molecular weight: 140.13662

Ref: 54-OR21731

4,5-Dimethyl-2-furoic acid

CAS: 89639-83-8

Formula: C₇H₈O₃

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 140.138

Ref: 10-F013553

4,5-Dimethyl-2-furoic acid

CAS: 89639-83-8

4,5-Dimethyl-2-furoic acid is a substance that is used in the manufacture of sodium bicarbonate. It is generated from sodium sulfate by heating with a sodium bicarbonate solution and then extracting with ether. The resulting racemic form can be converted to the desired enantiomer by reacting with an adapter such as sodium bicarbonate or by fractional crystallization.

Formula: C₇H₈O₃

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 140.14 g/mol

Ref: 3D-FD172339

4,5-Dimethylfuran-2-carboxylic acid

CAS: 89639-83-8

4,5-Dimethylfuran-2-carboxylic acid

Formula: C₇H₈O₃

Purity: 95+%

Molecular weight: 140.14

Ref: IN-DG5014