CymitQuimica logo

CAS 89642-23-9

:

5-bromo-2-nitrobenzamide

Description:
5-Bromo-2-nitrobenzamide is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with both a bromine atom and a nitro group, as well as an amide functional group. The presence of the bromine atom at the 5-position and the nitro group at the 2-position of the benzene ring contributes to its reactivity and potential applications in various chemical reactions. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests that it could participate in electrophilic substitution reactions due to the electron-withdrawing nature of the nitro group, which can influence the reactivity of the aromatic ring. Additionally, the amide functional group may impart certain polar characteristics, affecting its interactions with other molecules. 5-Bromo-2-nitrobenzamide is of interest in medicinal chemistry and materials science, where it may serve as a precursor or intermediate in the synthesis of more complex compounds.
Formula:C7H5BrN2O3
InChI:InChI=1/C7H5BrN2O3/c8-4-1-2-6(10(12)13)5(3-4)7(9)11/h1-3H,(H2,9,11)
SMILES:c1cc(c(cc1Br)C(=N)O)N(=O)=O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.