CAS 89642-50-2

5-Bromo-2-nitrobenzonitrile

Description:

5-Bromo-2-nitrobenzonitrile is an organic compound characterized by its aromatic structure, which includes a bromine atom and a nitro group attached to a benzene ring that also contains a cyano group (nitrile). The presence of the bromine atom introduces a halogen, which can influence the compound's reactivity and physical properties, such as solubility and boiling point. The nitro group is a strong electron-withdrawing group, which can enhance the compound's electrophilic reactivity, making it useful in various chemical reactions, including nucleophilic substitutions. The cyano group contributes to the compound's overall polarity and can participate in further chemical transformations. Typically, compounds like 5-Bromo-2-nitrobenzonitrile are utilized in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Its molecular structure allows for potential applications in materials science and as an intermediate in the synthesis of more complex organic molecules. Safety data should be consulted, as halogenated and nitro compounds can pose health and environmental risks.

Formula: C₇H₃BrN₂O₂

InChI: InChI=1S/C7H3BrN2O2/c8-6-1-2-7(10(11)12)5(3-6)4-9/h1-3H

InChI key: InChIKey=LCNNOEPOXHHUQG-UHFFFAOYSA-N

SMILES: C(#N)C1=C(N(=O)=O)C=CC(Br)=C1

Synonyms:

• NSC 263787
• 5-Bromo-2-nitrobenzonitrile
• Benzonitrile, 5-bromo-2-nitro-

5-Bromo-2-Nitrobenzonitrile

CAS: 89642-50-2

Formula: C₇H₃BrN₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 227.0149

Ref: IN-DA003W38

5-Bromo-2-nitrobenzonitrile

CAS: 89642-50-2

5-Bromo-2-nitrobenzonitrile

Formula: C₇H₃BrN₂O₂

Purity: ≥95%

Color and Shape: lemon solid

Molecular weight: 227.01g/mol

Ref: 54-OR30919

5-Bromo-2-nitrobenzonitrile

CAS: 89642-50-2

Formula: C₇H₃BrN₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 227.017

Ref: 10-F225353