
CAS 896423-22-6
:N-[3-(3-Hydroxyphenoxy)phenyl]acetamide
Description:
N-[3-(3-Hydroxyphenoxy)phenyl]acetamide, with the CAS number 896423-22-6, is an organic compound characterized by its amide functional group and a complex aromatic structure. This compound features a phenyl ring substituted with a hydroxyphenoxy group, which contributes to its potential biological activity. The presence of the acetamide moiety suggests that it may exhibit properties typical of amides, such as moderate solubility in polar solvents and the ability to participate in hydrogen bonding. The hydroxy group on the aromatic ring can enhance its reactivity and solubility in aqueous environments, making it of interest in medicinal chemistry. Additionally, the compound may possess specific pharmacological properties, which could be explored in drug development. Its structural characteristics indicate potential applications in various fields, including pharmaceuticals and materials science. However, detailed studies would be necessary to fully understand its behavior, stability, and interactions in different environments.
Formula:C14H13NO3
InChI:InChI=1S/C14H13NO3/c1-10(16)15-11-4-2-6-13(8-11)18-14-7-3-5-12(17)9-14/h2-9,17H,1H3,(H,15,16)
InChI key:InChIKey=DJEXVQMETIFKRU-UHFFFAOYSA-N
SMILES:O(C1=CC(NC(C)=O)=CC=C1)C2=CC(O)=CC=C2
Synonyms:- Acetamide, N-[3-(3-hydroxyphenoxy)phenyl]-
- N-[3-(3-Hydroxyphenoxy)phenyl]acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
