CAS 896447-13-5
:1-(Hexyloxy)-1-(3-methylbutoxy)hexane
Description:
1-(Hexyloxy)-1-(3-methylbutoxy)hexane, with the CAS number 896447-13-5, is an organic compound characterized by its long hydrocarbon chains and ether functional groups. This substance features a hexyl group and a 3-methylbutyl group connected through ether linkages, which contribute to its hydrophobic nature. The presence of these alkyl chains typically results in low solubility in water but good solubility in organic solvents. The compound may exhibit properties such as moderate volatility and a relatively high boiling point due to its larger molecular size. Its structure suggests potential applications in fields such as surfactants, lubricants, or as a solvent in various chemical processes. Additionally, the branched structure of the 3-methylbutoxy group may influence its physical properties, such as viscosity and density. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.
Formula:C17H36O2
InChI:InChI=1S/C17H36O2/c1-5-7-9-11-14-18-17(12-10-8-6-2)19-15-13-16(3)4/h16-17H,5-15H2,1-4H3
InChI key:InChIKey=BFNIPPNBSJGEQI-UHFFFAOYSA-N
SMILES:C(OCCC(C)C)(OCCCCCC)CCCCC
Synonyms:- Hexane, 1-(hexyloxy)-1-(3-methylbutoxy)-
- 1-(Hexyloxy)-1-(3-methylbutoxy)hexane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
