CAS 896464-16-7
:tert-Butyl 2,7-diazaspiro[3.5]nonane-7-carboxylate
Description:
Tert-Butyl 2,7-diazaspiro[3.5]nonane-7-carboxylate is a chemical compound characterized by its unique spirocyclic structure, which features a bicyclic framework containing nitrogen atoms. This compound belongs to the class of spiro compounds, which are known for their distinctive arrangement of atoms that can influence their chemical reactivity and physical properties. The presence of the tert-butyl group contributes to its steric bulk, potentially affecting solubility and reactivity. The carboxylate functional group indicates that the compound can participate in various chemical reactions, such as esterification or nucleophilic substitution. Additionally, the diaza configuration suggests that the compound may exhibit interesting coordination chemistry and biological activity, making it a candidate for further research in medicinal chemistry or materials science. Its specific properties, such as melting point, boiling point, and solubility, would need to be determined experimentally, as they can vary based on the compound's purity and the conditions under which they are measured.
Formula:C12H22N2O2
InChI:InChI=1/C12H22N2O2.ClH/c1-11(2,3)16-10(15)14-8-12(9-14)4-6-13-7-5-12;/h13H,4-9H2,1-3H3;1H
SMILES:CC(C)(C)OC(=O)N1CC2(CCNCC2)C1.Cl
Synonyms:- 2,7-Diazaspiro[3.5]nonane-7-carboxylic acid 1,1-dimethylethyl ester
- tert-Butyl 2,7-diazaspiro[3,5]nonane-7-carboxylate
- 2,7-Diazaspiro[3.5]nonane-2-carboxylic acid, 1,1-dimethylethyl ester, hydrochloride (1:1)
- 2,7-Diaza-spiro[3.5]nonane-7-carboxylic acid tert-butyl ester
- tert-Butyl 2,7-diazaspiro[3.5]nonane-7-carboxylate?New
- 2,7-Diazaspiro[3.5]nonane-7-carboxylic acid tert-butyl ester hydrochloride
- 2,7-Diazaspiro[3.5]nonane-7-carboxylicacid, 1,1-diMethylethyl ester dihydrochloride
- tert-Butyl 2,7-diazaspiro[3.5]nonane-7-carboxylate 98%
- tert-Butyl 2,7-diazaspiro[3.5]none-7-carboxylate
- tert-butyl 2,7-diazaspiro(3,5)nonane-7-carboxylate hcl
- 7-Boc-2,7-diaza-spiro3.5none
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
tert-Butyl 2,7-diazaspiro[3.5]nonane-7-carboxylate
CAS:Formula:C12H22N2O2Purity:97%Color and Shape:SolidMolecular weight:226.3153tert-Butyl 2,7-diazaspiro[3.5]nonane-7-carboxylate
CAS:tert-Butyl 2,7-diazaspiro[3.5]nonane-7-carboxylateFormula:C12H22N2O2Purity:98%Color and Shape: off white to light yellow low melting solidMolecular weight:226.32g/mol2,7-Diazaspiro[3.5]nonane-7-carboxylic acid 1,1-dimethyl ethyl ester
CAS:Formula:C12H22N2O2Purity:95%Color and Shape:SolidMolecular weight:226.32Ref: 10-F093521
1g21.00€5g87.00€10g157.00€25g314.00€50g563.00€100g877.00€250g1,636.00€100mg12.00€250mg14.00€tert-Butyl 2,7-diazaspiro[3.5]nonane-7-carboxylate
CAS:<p>Please enquire for more information about tert-Butyl 2,7-diazaspiro[3.5]nonane-7-carboxylate including the price, delivery time and more detailed product information at the technical inquiry form on this page</p>Formula:C12H22N2O2Purity:Min. 95%Molecular weight:226.32 g/mol



