CymitQuimica logo

CAS 89647-68-7

:

(6aS,11aS)-9-methoxy-6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromene-3,7-diol

Description:
The chemical substance known as "(6aS,11aS)-9-methoxy-6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromene-3,7-diol," with the CAS number 89647-68-7, is a complex organic compound characterized by its unique bicyclic structure that incorporates both benzofuran and chromene moieties. This compound features multiple functional groups, including methoxy and hydroxyl groups, which contribute to its potential biological activity and solubility properties. The stereochemistry indicated by the (6aS,11aS) configuration suggests specific spatial arrangements of atoms that may influence its interactions with biological targets. Such compounds are often studied for their pharmacological properties, including antioxidant, anti-inflammatory, or anticancer activities. The presence of hydroxyl groups typically enhances hydrogen bonding capabilities, potentially affecting the compound's reactivity and solubility in various solvents. Overall, this substance represents a class of compounds that may have significant implications in medicinal chemistry and drug development.
Formula:C16H14O5
InChI:InChI=1/C16H14O5/c1-19-9-5-12(18)15-11-7-20-13-4-8(17)2-3-10(13)16(11)21-14(15)6-9/h2-6,11,16-18H,7H2,1H3/t11-,16-/m1/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.