CymitQuimica logo

CAS 89647-87-0

:

(3aR,4R,6aR,8S,9aR,9bR)-4,8-dihydroxy-3,6,9-trimethylidenedecahydroazuleno[4,5-b]furan-2(3H)-one

Description:
The chemical substance with the name "(3aR,4R,6aR,8S,9aR,9bR)-4,8-dihydroxy-3,6,9-trimethylidenedecahydroazuleno[4,5-b]furan-2(3H)-one" and CAS number "89647-87-0" is a complex organic compound characterized by its unique bicyclic structure, which includes multiple chiral centers. This compound features a furan ring fused to an azulene moiety, contributing to its distinctive chemical properties. The presence of hydroxyl groups at the 4 and 8 positions indicates potential for hydrogen bonding, which can influence its solubility and reactivity. The trimethylidene groups suggest a degree of unsaturation, which may impart stability and reactivity under certain conditions. Such compounds often exhibit interesting biological activities, making them of interest in medicinal chemistry and natural product research. The stereochemistry of the molecule is crucial for its biological interactions, as the spatial arrangement of atoms can significantly affect its pharmacological properties. Overall, this compound exemplifies the complexity and diversity found in organic chemistry, particularly in the realm of natural product derivatives.
Formula:C15H18O4
InChI:InChI=1/C15H18O4/c1-6-4-11(17)13-8(3)15(18)19-14(13)12-7(2)10(16)5-9(6)12/h9-14,16-17H,1-5H2/t9-,10-,11+,12-,13+,14+/m0/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.