CymitQuimica logo

CAS 89648-76-0

:

(Z)-7-[(1R,2S)-[(3S,4S)-3-Hydroxy-4-methyloct-1-y-nyl]-5-oxocyclopentyl]-5-heptenoic acid methyl es-ter

Description:
The chemical substance known as (Z)-7-[(1R,2S)-[(3S,4S)-3-Hydroxy-4-methyloct-1-ynyl]-5-oxocyclopentyl]-5-heptenoic acid methyl ester, with the CAS number 89648-76-0, is characterized by its complex structure that includes multiple stereocenters and functional groups. This compound features a heptenoic acid backbone, indicating the presence of a long carbon chain with a double bond, specifically in the Z configuration, which denotes the relative positioning of substituents around the double bond. The presence of a cyclopentyl ring and a ketone group contributes to its reactivity and potential biological activity. Additionally, the hydroxyl group suggests that the compound may exhibit polar characteristics, influencing its solubility and interaction with biological systems. The methyl ester functionality indicates that it can undergo hydrolysis to release the corresponding acid, which may have implications for its stability and reactivity in various environments. Overall, this compound's unique structural features may confer specific properties that are of interest in medicinal chemistry and organic synthesis.
Formula:C22H34O4
InChI:InChI=1/C22H34O4/c1-4-5-10-17(2)20(23)15-13-18-14-16-21(24)19(18)11-8-6-7-9-12-22(25)26-3/h6,8,17-20,23H,4-5,7,9-12,14,16H2,1-3H3/b8-6-/t17-,18-,19+,20+/m0/s1
Synonyms:
  • Fce-20700
  • methyl (5Z,15S,16S)-15-hydroxy-16-methyl-9-oxoprost-5-en-13-yn-1-oate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.