CymitQuimica logo

CAS 896523-47-0

:

[4-(3-methylphenyl)piperazin-1-yl]acetic acid

Description:
[4-(3-methylphenyl)piperazin-1-yl]acetic acid, with the CAS number 896523-47-0, is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a 3-methylphenyl group attached to the piperazine, contributing to its lipophilicity and potential biological activity. The acetic acid moiety indicates the presence of a carboxylic acid functional group, which can participate in hydrogen bonding and influence the compound's solubility and reactivity. Typically, compounds of this nature may exhibit pharmacological properties, making them of interest in medicinal chemistry, particularly in the development of drugs targeting neurological or psychiatric disorders. The presence of both aromatic and aliphatic components suggests potential interactions with various biological targets. Additionally, the compound's structure may allow for modifications that can enhance its efficacy or selectivity in therapeutic applications. Overall, [4-(3-methylphenyl)piperazin-1-yl]acetic acid represents a class of compounds that bridge organic chemistry and pharmacology.
Formula:C13H18N2O2
InChI:InChI=1/C13H18N2O2/c1-11-3-2-4-12(9-11)15-7-5-14(6-8-15)10-13(16)17/h2-4,9H,5-8,10H2,1H3,(H,16,17)
SMILES:Cc1cccc(c1)N1CCN(CC1)CC(=O)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.