CAS 89655-71-0

2,6-Dichloro-β-methylbenzeneethanamine

Description:

2,6-Dichloro-β-methylbenzeneethanamine, also known by its CAS number 89655-71-0, is an organic compound characterized by the presence of a benzene ring substituted with two chlorine atoms at the 2 and 6 positions, and an ethylamine group attached to a β-methyl group. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in polar solvents. The dichloro substitution on the aromatic ring can enhance the compound's reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the presence of chlorine atoms may impart specific electronic effects, affecting the compound's overall stability and reactivity. The compound's structure suggests potential applications in pharmaceuticals or agrochemicals, although specific uses would depend on further research into its biological activity and toxicity. As with many chlorinated compounds, safety precautions should be taken due to potential environmental and health impacts.

Formula: C₉H₁₁Cl₂N

InChI: InChI=1S/C9H11Cl2N/c1-6(5-12)9-7(10)3-2-4-8(9)11/h2-4,6H,5,12H2,1H3

InChI key: InChIKey=RTJCYJHRXNHNCB-UHFFFAOYSA-N

SMILES: C(CN)(C)C1=C(Cl)C=CC=C1Cl

Synonyms:

• 2-(2,6-Dichlorophenyl)propylamine
• 2,6-Dichloro-β-methylbenzeneethanamine
• Benzeneethanamine, 2,6-dichloro-β-methyl-
• 2-(2,6-Dichlorophenyl)propan-1-amine

2-(2,6-Dichlorophenyl)propan-1-amine

Controlled Product

CAS: 89655-71-0

Versatile small molecule scaffold

Formula: C₉H₁₁Cl₂N

Purity: Min. 95%

Molecular weight: 204.09 g/mol

Ref: 3D-PDA65571