CAS 89660-15-1
:Carbamic acid, (6-chloro-3-pyridinyl)-, ethyl ester
Description:
Carbamic acid, (6-chloro-3-pyridinyl)-, ethyl ester, with the CAS number 89660-15-1, is an organic compound characterized by its carbamate functional group. This substance features a pyridine ring substituted with a chlorine atom at the 6-position and an ethyl ester group. It typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. The compound is known for its potential applications in agricultural chemistry, particularly as a pesticide or herbicide, due to its ability to inhibit certain enzymes in target organisms. Its chemical structure contributes to its reactivity and solubility properties, making it suitable for various formulations. Safety data indicates that, like many carbamates, it may pose risks to human health and the environment, necessitating careful handling and usage guidelines. Overall, this compound exemplifies the diverse functionalities of carbamic acids in synthetic and applied chemistry.
Formula:C8H9ClN2O2
InChI:InChI=1S/C8H9ClN2O2/c1-2-13-8(12)11-6-3-4-7(9)10-5-6/h3-5H,2H2,1H3,(H,11,12)
InChI key:InChIKey=ZKJFDWOFTPBEQX-UHFFFAOYSA-N
SMILES:N(C(OCC)=O)C=1C=CC(Cl)=NC1
Synonyms:- Carbamic acid, (6-chloro-3-pyridinyl)-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
