CAS 896618-52-3
:ethyl 4-(thiophene-3-carbonyl)benzoate
Description:
Ethyl 4-(thiophene-3-carbonyl)benzoate is an organic compound characterized by its ester functional group, which is derived from benzoic acid and ethyl alcohol. The structure features a thiophene ring, a five-membered aromatic heterocycle containing sulfur, attached to a carbonyl group, which contributes to its reactivity and potential applications in organic synthesis. This compound typically exhibits moderate solubility in organic solvents due to its hydrophobic aromatic components. Its molecular structure suggests potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis, particularly in the development of materials with electronic or optical properties. The presence of both the thiophene and benzoate moieties may impart unique electronic characteristics, making it of interest in research related to organic electronics or as a ligand in coordination chemistry. As with many organic compounds, safety data should be consulted for handling and storage, as it may pose health risks if ingested or inhaled.
Formula:C14H12O3S
InChI:InChI=1/C14H12O3S/c1-2-17-14(16)11-5-3-10(4-6-11)13(15)12-7-8-18-9-12/h3-9H,2H2,1H3
SMILES:CCOC(=O)c1ccc(cc1)C(=O)c1ccsc1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
