CAS 896618-56-7

(4-chlorophenyl)-(3-thienyl)methanone

Description:

(4-chlorophenyl)-(3-thienyl)methanone, identified by its CAS number 896618-56-7, is an organic compound characterized by the presence of a ketone functional group attached to a thienyl ring and a chlorophenyl moiety. The structure features a thienyl group, which is a five-membered aromatic ring containing sulfur, contributing to its unique electronic properties. The chlorophenyl group, with a chlorine substituent on the phenyl ring, enhances the compound's reactivity and may influence its biological activity. This compound is typically studied in the context of medicinal chemistry and material science due to its potential applications in drug development and as a building block in organic synthesis. Its properties, such as solubility, melting point, and stability, can vary based on the specific conditions and solvents used. Overall, (4-chlorophenyl)-(3-thienyl)methanone represents a versatile structure with significant implications in various chemical research fields.

Formula: C₁₁H₇ClOS

InChI: InChI=1/C11H7ClOS/c12-10-3-1-8(2-4-10)11(13)9-5-6-14-7-9/h1-7H

SMILES: c1cc(ccc1C(=O)c1ccsc1)Cl

3-(4-Chlorobenzoyl)thiophene

CAS: 896618-56-7

Formula: C₁₁H₇ClOS

Molecular weight: 222.6907

Ref: IN-DA0044WS

3-(4-Chlorobenzoyl)thiophene

CAS: 896618-56-7

Formula: C₁₁H₇ClOS

Purity: 97.0%

Molecular weight: 222.69

Ref: 10-F202329

(4-Chlorophenyl)(thiophen-3-yl)methanone

CAS: 896618-56-7

Versatile small molecule scaffold

Formula: C₁₁H₇ClOS

Purity: Min. 95%

Molecular weight: 222.69 g/mol

Ref: 3D-WKB61856