CAS 896618-58-9

(2,3-Dimethylphenyl)-3-thienylmethanone

Description:

(2,3-Dimethylphenyl)-3-thienylmethanone, with the CAS number 896618-58-9, is an organic compound characterized by its unique structure, which includes a thienyl group and a dimethyl-substituted phenyl group. This compound typically exhibits properties associated with aromatic ketones, such as stability and moderate reactivity due to the presence of the carbonyl functional group. The thienyl moiety contributes to its potential electronic properties and reactivity, making it of interest in various chemical applications, including organic synthesis and material science. The presence of the dimethyl groups on the phenyl ring can influence the compound's steric and electronic characteristics, potentially affecting its solubility and interaction with other molecules. As with many organic compounds, its behavior in different solvents and under various conditions can vary significantly, impacting its applications in pharmaceuticals, agrochemicals, or as intermediates in chemical synthesis. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₃H₁₂OS

InChI: InChI=1S/C13H12OS/c1-9-4-3-5-12(10(9)2)13(14)11-6-7-15-8-11/h3-8H,1-2H3

InChI key: InChIKey=SSQQVQVYUDJNFC-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(C)C(C)=CC=C1)C=2C=CSC2

Synonyms:

• (2,3-Dimethylphenyl)-3-thienylmethanone
• Methanone, (2,3-dimethylphenyl)-3-thienyl-