CymitQuimica logo

CAS 89664-15-3

:

N-(Cyanomethyl)-5-(dimethylamino)-1-naphthalenesulfonamide

Description:
N-(Cyanomethyl)-5-(dimethylamino)-1-naphthalenesulfonamide, with the CAS number 89664-15-3, is a chemical compound that features a naphthalene ring substituted with a sulfonamide group and a cyanomethyl group. This compound is characterized by its sulfonamide functional group, which typically imparts properties such as solubility in polar solvents and potential biological activity. The presence of the dimethylamino group suggests that it may exhibit basic properties, influencing its reactivity and interaction with other molecules. The cyanomethyl group can serve as a reactive site for further chemical modifications or reactions. This compound may be of interest in various fields, including medicinal chemistry, due to its potential applications in drug development or as a synthetic intermediate. Its specific physical and chemical properties, such as melting point, boiling point, and solubility, would need to be determined through experimental methods or referenced from chemical databases. Overall, this compound represents a unique structure that could be explored for various chemical applications.
Formula:C14H15N3O2S
InChI:InChI=1S/C14H15N3O2S/c1-17(2)13-7-3-6-12-11(13)5-4-8-14(12)20(18,19)16-10-9-15/h3-8,16H,10H2,1-2H3
InChI key:InChIKey=HAIIXWXURVTTCG-UHFFFAOYSA-N
SMILES:S(NCC#N)(=O)(=O)C=1C2=C(C(N(C)C)=CC=C2)C=CC1
Synonyms:
  • 1-Naphthalenesulfonamide, N-(cyanomethyl)-5-(dimethylamino)-
  • N-(Cyanomethyl)-5-(dimethylamino)-1-naphthalenesulfonamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.