CAS 89665-72-5

5-{[(2-ethylphenyl)amino]methyl}-2-thioxo-2,3-dihydropyrimidin-4(1H)-one

Description:

5-{[(2-ethylphenyl)amino]methyl}-2-thioxo-2,3-dihydropyrimidin-4(1H)-one, with the CAS number 89665-72-5, is a chemical compound that belongs to the class of thioxo-pyrimidinones. This substance features a pyrimidine ring substituted with a thioxo group and an aminoalkyl side chain, which contributes to its potential biological activity. The presence of the 2-ethylphenyl group suggests that it may exhibit lipophilic characteristics, potentially influencing its solubility and interaction with biological membranes. The thioxo group can enhance reactivity, making it a candidate for various chemical transformations. This compound may be of interest in medicinal chemistry due to its structural features, which could be linked to pharmacological properties. However, specific data regarding its toxicity, stability, and reactivity would require further investigation through experimental studies. Overall, the unique structural attributes of this compound suggest potential applications in drug development or as a research tool in organic synthesis.

Formula: C₁₃H₁₅N₃OS

InChI: InChI=1/C13H15N3OS/c1-2-9-5-3-4-6-11(9)14-7-10-8-15-13(18)16-12(10)17/h3-6,8,14H,2,7H2,1H3,(H2,15,16,17,18)

5-(N-ETHYL(PHENYLAMINO))METHYL-2-THIOURACIL

CAS: 89665-72-5

Formula: C₁₃H₁₅N₃OS

Molecular weight: 261.3427

Ref: IN-DA0043WH