CymitQuimica logo

CAS 89665-74-7

:

5-(morpholin-4-ylmethyl)-2-thioxo-2,3-dihydropyrimidin-4(1H)-one

Description:
5-(Morpholin-4-ylmethyl)-2-thioxo-2,3-dihydropyrimidin-4(1H)-one, with the CAS number 89665-74-7, is a chemical compound that belongs to the class of thioxo-pyrimidinones. This substance features a pyrimidine ring substituted with a thioxo group and a morpholine moiety, which contributes to its unique properties. The presence of the morpholine group enhances its solubility in polar solvents and may influence its biological activity. The compound is characterized by its potential as a pharmacological agent, with research indicating possible applications in medicinal chemistry, particularly in the development of antiviral or anticancer drugs. Its structure suggests the ability to participate in hydrogen bonding and other interactions, which can affect its reactivity and binding affinity to biological targets. Additionally, the thioxo group may impart specific electronic properties that can be exploited in various chemical reactions. Overall, this compound represents a significant interest in the field of drug discovery and development due to its structural features and potential therapeutic applications.
Formula:C9H13N3O2S
InChI:InChI=1/C9H13N3O2S/c13-8-7(5-10-9(15)11-8)6-12-1-3-14-4-2-12/h5H,1-4,6H2,(H2,10,11,13,15)
SMILES:C1COCCN1Cc1cnc(nc1O)S
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.