CAS 89665-78-1

5-{[(2-methylphenyl)amino]methyl}-2-thioxo-2,3-dihydropyrimidin-4(1H)-one

Description:

The chemical substance known as 5-{[(2-methylphenyl)amino]methyl}-2-thioxo-2,3-dihydropyrimidin-4(1H)-one, with the CAS number 89665-78-1, is a pyrimidine derivative characterized by its thioxo group and an aminoalkyl substituent. This compound features a dihydropyrimidinone core, which is a bicyclic structure that includes both a pyrimidine and a ketone functionality. The presence of the 2-methylphenyl group suggests that it has aromatic characteristics, potentially influencing its solubility and reactivity. The thioxo group contributes to the compound's chemical properties, possibly enhancing its reactivity in various chemical reactions. This substance may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structural complexity allows for various interactions with biological targets, which could be explored in pharmacological studies. Overall, this compound represents a unique class of heterocyclic compounds with potential applications in various fields, including pharmaceuticals and organic synthesis.

Formula: C₁₂H₁₃N₃OS

InChI: InChI=1/C12H13N3OS/c1-8-4-2-3-5-10(8)13-6-9-7-14-12(17)15-11(9)16/h2-5,7,13H,6H2,1H3,(H2,14,15,16,17)

5-((Methyl(phenyl)amino)methyl)-2-thioxo-2,3-dihydropyrimidin-4(1H)-one

CAS: 89665-78-1

Formula: C₁₂H₁₃N₃OS

Molecular weight: 247.3161

Ref: IN-DA0043I7