CAS 89667-41-4
:7-Octenoic acid, 8-phenyl-8-(3-pyridinyl)-, (Z)-
Description:
7-Octenoic acid, 8-phenyl-8-(3-pyridinyl)-, (Z)-, with the CAS number 89667-41-4, is an organic compound characterized by its unique structure that includes both an octenoic acid backbone and a phenyl-pyridine substituent. This compound features a double bond in the octenoic acid chain, specifically in the Z configuration, indicating that the substituents on the double bond are on the same side, which can influence its reactivity and physical properties. The presence of the phenyl and pyridine groups contributes to its potential biological activity and solubility characteristics. Typically, compounds of this nature may exhibit properties such as moderate to high lipophilicity due to the aromatic rings, which can affect their interaction with biological systems. Additionally, the presence of the carboxylic acid functional group suggests potential for hydrogen bonding and reactivity in various chemical environments. Overall, this compound may be of interest in fields such as medicinal chemistry, materials science, or organic synthesis due to its structural complexity and potential applications.
Formula:C19H21NO2
InChI:InChI=1S/C19H21NO2/c21-19(22)13-7-2-1-6-12-18(16-9-4-3-5-10-16)17-11-8-14-20-15-17/h3-5,8-12,14-15H,1-2,6-7,13H2,(H,21,22)/b18-12-
InChI key:InChIKey=WSPYFANRPUFZCC-PDGQHHTCSA-N
SMILES:C(=C/CCCCCC(O)=O)(\C1=CC=CC=C1)/C=2C=CC=NC2
Synonyms:- 7-Octenoic acid, 8-phenyl-8-(3-pyridinyl)-, (Z)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
