
CAS 89671-85-2
:1-(5-Methoxy-1H-indol-2-yl)ethanone
Description:
1-(5-Methoxy-1H-indol-2-yl)ethanone, with the CAS number 89671-85-2, is an organic compound that features an indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This particular compound is characterized by the presence of a methoxy group (-OCH3) at the 5-position of the indole ring and an ethanone (acetyl) functional group at the 1-position. The methoxy group contributes to the compound's polarity and can influence its reactivity and solubility in various solvents. The ethanone moiety introduces a carbonyl group, which can participate in various chemical reactions, such as nucleophilic additions. This compound may exhibit biological activity, as many indole derivatives are known for their pharmacological properties. Its synthesis typically involves the acetylation of the indole precursor, and it can be analyzed using techniques such as NMR spectroscopy and mass spectrometry to confirm its structure and purity. Overall, 1-(5-Methoxy-1H-indol-2-yl)ethanone is of interest in both synthetic organic chemistry and medicinal chemistry.
Formula:C11H11NO2
InChI:InChI=1S/C11H11NO2/c1-7(13)11-6-8-5-9(14-2)3-4-10(8)12-11/h3-6,12H,1-2H3
InChI key:InChIKey=KQNPURWHIHMGEZ-UHFFFAOYSA-N
SMILES:C(C)(=O)C1=CC=2C(N1)=CC=C(OC)C2
Synonyms:- 1-(5-Methoxy-1H-indol-2-yl)ethanone
- Ethanone, 1-(5-methoxy-1H-indol-2-yl)-
- 1-(5-Methoxy-1H-indol-2-yl)ethan-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
