CAS 896722-50-2

1-(benzenesulfonyl)-6-chloro-pyrrolo[2,3-b]pyridine

Description:

1-(Benzenesulfonyl)-6-chloro-pyrrolo[2,3-b]pyridine, with the CAS number 896722-50-2, is a chemical compound characterized by its unique structural features, which include a pyrrolo[2,3-b]pyridine core substituted with a benzenesulfonyl group and a chlorine atom. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and solubility in organic solvents. The presence of the sulfonyl group may enhance its reactivity and ability to form interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the chlorine atom can influence the compound's electronic properties and steric hindrance, which may affect its pharmacokinetics and pharmacodynamics. Overall, this compound's structural characteristics suggest potential applications in drug development, particularly in the search for novel therapeutic agents. However, specific physical and chemical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.

Formula: C₁₃H₉ClN₂O₂S

InChI: InChI=1/C13H9ClN2O2S/c14-12-7-6-10-8-9-16(13(10)15-12)19(17,18)11-4-2-1-3-5-11/h1-9H

SMILES: c1ccc(cc1)S(=O)(=O)n1ccc2ccc(Cl)nc12

Synonyms:

• 6-Chlor-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridin
• 6-chloro-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine

6-Chloro-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine

CAS: 896722-50-2

Formula: C₁₃H₉ClN₂O₂S

Purity: 95%

Color and Shape: Solid

Molecular weight: 292.7408

Ref: IN-DA0043SI

6-Chloro-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine

CAS: 896722-50-2

6-Chloro-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine

Purity: 95%

Molecular weight: 292.75g/mol

Ref: 54-OR1045105

6-Chloro-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine

CAS: 896722-50-2

Formula: C₁₃H₉ClN₂O₂S

Purity: 95%

Molecular weight: 292.74

Ref: 10-F229700