
CAS 89673-52-9
:3-[[4-(Pentyloxy)phenyl]methylene]-1(3H)-isobenzofuranone
Description:
3-[[4-(Pentyloxy)phenyl]methylene]-1(3H)-isobenzofuranone, with the CAS number 89673-52-9, is an organic compound characterized by its complex structure, which includes a benzofuranone core and a pentyloxy-substituted phenyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential applications in organic synthesis and materials science. The presence of the pentyloxy group enhances its solubility in organic solvents, while the benzofuranone moiety may impart interesting photophysical properties, making it a candidate for studies in fluorescence or as a dye. Additionally, the compound's structure suggests potential biological activity, which could be explored in medicinal chemistry. Its stability and reactivity can be influenced by the substituents on the aromatic rings, allowing for further functionalization. Overall, this compound represents a unique intersection of structural features that may lead to diverse applications in various fields of chemistry.
Formula:C20H20O3
InChI:InChI=1S/C20H20O3/c1-2-3-6-13-22-16-11-9-15(10-12-16)14-19-17-7-4-5-8-18(17)20(21)23-19/h4-5,7-12,14H,2-3,6,13H2,1H3
InChI key:InChIKey=UEZGZBJAHOFZAQ-UHFFFAOYSA-N
SMILES:C(=C1C=2C(C(=O)O1)=CC=CC2)C3=CC=C(OCCCCC)C=C3
Synonyms:- 1(3H)-Isobenzofuranone, 3-[[4-(pentyloxy)phenyl]methylene]-
- 3-[[4-(Pentyloxy)phenyl]methylene]-1(3H)-isobenzofuranone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
