CAS 89673-71-2

lactamide

Description:

Lactamide, with the CAS number 89673-71-2, is an organic compound characterized by its amide functional group attached to a lactone structure. It typically appears as a white to off-white solid and is soluble in water and various organic solvents, which makes it versatile in chemical applications. Lactamide is known for its potential use in pharmaceuticals and as an intermediate in organic synthesis. Its structure allows for hydrogen bonding, contributing to its solubility and reactivity. The compound may exhibit biological activity, making it of interest in medicinal chemistry. Additionally, lactamide can participate in various chemical reactions, including hydrolysis and condensation, which are essential in synthetic pathways. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken. Overall, lactamide's unique properties and reactivity profile make it a valuable compound in both research and industrial applications.

Formula: C₃H₇NO₂

InChI: InChI=1/C3H7NO2/c1-2(5)3(4)6/h2,5H,1H3,(H2,4,6)/t2-/m0/s1

SMILES: C[C@@H](C(=N)O)O

Synonyms:

• 2-Hydroxypropionamide
• (2S)-2-Hydroxypropionamide = Lactamide
• 2-Hydroxypropanamide
• (2S)-2-hydroxypropanamide

(S)-2-Hydroxypropanamide

CAS: 89673-71-2

Formula: C₃H₇NO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 89.0932

Ref: IN-DA003CE5

(S)-2-hydroxypropanamide

CAS: 89673-71-2

(S)-2-hydroxypropanamide

Purity: 95%

Molecular weight: 89.09g/mol

Ref: 54-OR79504

(S)-(-)-Lactamide

CAS: 89673-71-2

Ref: 7W-GE8771

(S)-2-hydroxypropanamide

CAS: 89673-71-2

Purity: 98.0%

Color and Shape: Solid, White to very pale yellow powder

Molecular weight: 89.0940017700195

Ref: 10-F152000

(S)-2-Hydroxypropanamide (S-Lactamide)

CAS: 89673-71-2

Formula: C₃H₇NO₂

Molecular weight: 89.09

Ref: 4Z-A-133033