CymitQuimica logo

CAS 89675-39-8

:

Chicamycin B

Description:
Chicamycin B is a natural antibiotic compound that belongs to the class of macrolides, specifically derived from the fermentation of certain Streptomyces species. It is characterized by its complex polycyclic structure, which includes a large lactone ring and various functional groups that contribute to its biological activity. Chicamycin B exhibits antibacterial properties, particularly against Gram-positive bacteria, making it of interest in pharmaceutical applications. Its mechanism of action typically involves inhibition of protein synthesis by binding to the bacterial ribosome. The compound is also noted for its potential immunosuppressive effects, which may have implications in therapeutic contexts. In terms of solubility, chicamycin B is generally more soluble in organic solvents than in water, which can affect its bioavailability and formulation in medicinal products. As with many antibiotics, the development of resistance is a concern, necessitating ongoing research into its efficacy and potential modifications to enhance its therapeutic profile.
Formula:C13H14N2O4
InChI:InChI=1/C13H14N2O4/c1-19-12-3-9-10(4-11(12)17)14-5-7-2-8(16)6-15(7)13(9)18/h3-5,7-8,16-17H,2,6H2,1H3/t7-,8-/m0/s1
Synonyms:
  • Chicamycin B
  • See more synonyms
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • Chicamycin B

    CAS:
    Chicamycin B exhibits antitumor properties and has mild activity against gram-positive bacteria.
    Formula:C13H14N2O4
    Color and Shape:Solid
    Molecular weight:262.261

    Ref: TM-TN9959

    10mg
    To inquire
    50mg
    To inquire