CymitQuimica logo

CAS 89677-69-0

:

3,5-dibromo-1,6-dimethyl-pyridin-2-one

Description:
3,5-Dibromo-1,6-dimethyl-pyridin-2-one is a heterocyclic organic compound characterized by a pyridine ring substituted with two bromine atoms and two methyl groups. The presence of the bromine atoms at the 3 and 5 positions contributes to its reactivity and potential applications in various chemical reactions, including electrophilic substitution. The dimethyl groups at the 1 and 6 positions enhance the lipophilicity of the molecule, which may influence its solubility in organic solvents. This compound may exhibit biological activity, making it of interest in medicinal chemistry and agrochemicals. Its structure suggests potential for coordination with metal ions, which could be relevant in catalysis or material science. Additionally, the presence of the carbonyl group in the pyridinone structure can participate in hydrogen bonding, affecting its physical properties such as melting point and boiling point. Overall, 3,5-dibromo-1,6-dimethyl-pyridin-2-one is a versatile compound with potential applications in various fields of chemistry.
Formula:C7H7Br2NO
InChI:InChI=1/C7H7Br2NO/c1-4-5(8)3-6(9)7(11)10(4)2/h3H,1-2H3
SMILES:Cc1c(cc(c(=O)n1C)Br)Br
Synonyms:
  • 2(1H)-pyridinone, 3,5-dibromo-1,6-dimethyl-
  • 3,5-Dibromo-1,6-dimethyl-1H-pyridin
  • -2-One
  • 3,5-Dibromo-1,6-dimethylpyridin-2(1H)-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.