CymitQuimica logo

CAS 89685-56-3

:

2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-Pentadecafluoro-N-methyloctanamide

Description:
2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-Pentadecafluoro-N-methyloctanamide, with CAS number 89685-56-3, is a fluorinated organic compound characterized by a long carbon chain and multiple fluorine substituents. This compound features a methyloctanamide structure, indicating the presence of an amide functional group attached to an octane backbone, which is further substituted with fluorine atoms. The extensive fluorination imparts unique properties, such as high thermal stability, low surface tension, and hydrophobicity, making it useful in various applications, including surfactants and coatings. Additionally, the presence of the amide group contributes to its potential as a polar solvent. However, the environmental impact and bioaccumulation potential of perfluorinated compounds are significant concerns, leading to increased scrutiny and regulation. Overall, this compound exemplifies the balance between functional utility and environmental considerations in the field of fluorinated chemicals.
Formula:C9H4F15NO
InChI:InChI=1S/C9H4F15NO/c1-25-2(26)3(10,11)4(12,13)5(14,15)6(16,17)7(18,19)8(20,21)9(22,23)24/h1H3,(H,25,26)
InChI key:InChIKey=CERVYTOBGGCMJN-UHFFFAOYSA-N
SMILES:C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(C(C(C(NC)=O)(F)F)(F)F)(F)F
Synonyms:
  • N-Methylperfluorooctanamide
  • Octanamide, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-N-methyl-
  • 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-Pentadecafluoro-N-methyloctanamide
  • N-Methylpentadecafluorooctanamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.