CAS 89686-23-7
:(2S)-1-(Phenylmethyl)-2-propylpiperidine
Description:
(2S)-1-(Phenylmethyl)-2-propylpiperidine, with the CAS number 89686-23-7, is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The compound features a phenylmethyl group and a propyl group attached to the piperidine nitrogen and carbon, respectively, contributing to its unique properties. As a chiral molecule, it exists in two enantiomeric forms, with the (2S) configuration indicating the specific spatial arrangement of its substituents. This compound may exhibit biological activity, potentially interacting with various receptors or enzymes, making it of interest in medicinal chemistry and pharmacology. Its solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Additionally, the presence of the phenyl and propyl groups can influence its lipophilicity, affecting its absorption and distribution in biological systems. Overall, (2S)-1-(Phenylmethyl)-2-propylpiperidine is a compound with potential applications in drug development and research.
Formula:C15H23N
InChI:InChI=1S/C15H23N/c1-2-8-15-11-6-7-12-16(15)13-14-9-4-3-5-10-14/h3-5,9-10,15H,2,6-8,11-13H2,1H3/t15-/m0/s1
InChI key:InChIKey=XDFBYVHAQLXSTC-HNNXBMFYSA-N
SMILES:C(N1[C@@H](CCC)CCCC1)C2=CC=CC=C2
Synonyms:- Piperidine, 1-(phenylmethyl)-2-propyl-, (S)-
- (2S)-1-(Phenylmethyl)-2-propylpiperidine
- (2S)-1-Benzyl-2-propylpiperidine
- Piperidine, 1-(phenylmethyl)-2-propyl-, (2S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
