
CAS 89691-95-2
:6-Methyl-4-pyrimidinecarboxylic acid hydrazide
Description:
6-Methyl-4-pyrimidinecarboxylic acid hydrazide is an organic compound characterized by its hydrazide functional group attached to a pyrimidine ring. This compound features a methyl group at the 6-position and a carboxylic acid moiety at the 4-position of the pyrimidine ring, contributing to its chemical reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the hydrazide and carboxylic acid groups. The compound may participate in various chemical reactions, including hydrazone formation and other condensation reactions, making it of interest in synthetic organic chemistry. Additionally, derivatives of pyrimidine compounds are often studied for their pharmacological properties, including antimicrobial and anti-inflammatory activities. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices.
Formula:C6H8N4O
InChI:InChI=1S/C6H8N4O/c1-4-2-5(6(11)10-7)9-3-8-4/h2-3H,7H2,1H3,(H,10,11)
InChI key:InChIKey=YDRQGYGLVJXTPN-UHFFFAOYSA-N
SMILES:C(NN)(=O)C=1C=C(C)N=CN1
Synonyms:- 4-Pyrimidinecarboxylic acid, 6-methyl-, hydrazide
- 6-Methyl-4-pyrimidinecarboxylic acid hydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
