CymitQuimica logo

CAS 897-21-2

:

[2,5-dichloro-4-(hydroxyimino)cyclohexa-2,5-dien-1-ylidene](4-methoxyphenyl)acetonitrile

Description:
[2,5-Dichloro-4-(hydroxyimino)cyclohexa-2,5-dien-1-ylidene](4-methoxyphenyl)acetonitrile, with the CAS number 897-21-2, is a chemical compound characterized by its complex structure, which includes a cyclohexadiene core substituted with dichloro and hydroxyimino groups, as well as a methoxyphenyl acetonitrile moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and stability. The presence of the hydroxyimino group suggests it may participate in various chemical reactions, including those typical of oximes, such as condensation and nucleophilic addition. The dichloro substituents can influence the electronic properties of the molecule, potentially enhancing its reactivity or altering its solubility in different solvents. Additionally, the methoxy group can affect the compound's polarity and interaction with biological systems, making it of interest in medicinal chemistry and material science. Overall, this compound's unique structural features may lead to diverse applications in organic synthesis and pharmaceuticals.
Formula:C15H10Cl2N2O2
InChI:InChI=1/C15H10Cl2N2O2/c1-21-10-4-2-9(3-5-10)12(8-18)11-6-14(17)15(19-20)7-13(11)16/h2-7,20H,1H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.