CymitQuimica logo

CAS 897-43-8

:

(3E)-N,N-dimethyl-4-[3-(methylsulfanyl)phenyl]-4-phenylbut-3-en-1-aminium chloride

Description:
(3E)-N,N-dimethyl-4-[3-(methylsulfanyl)phenyl]-4-phenylbut-3-en-1-aminium chloride, with CAS number 897-43-8, is a quaternary ammonium compound characterized by its complex structure featuring a butenyl chain, dimethylamino group, and a methylthio-substituted phenyl group. This compound typically appears as a solid or crystalline substance and is soluble in polar solvents due to its ionic nature. Its quaternary ammonium structure imparts cationic properties, making it useful in various applications, including as a surfactant, antimicrobial agent, or in formulations requiring cationic charge. The presence of the methylthio group can enhance its reactivity and influence its biological activity. Additionally, the compound may exhibit specific optical properties due to its conjugated double bond system, which can be relevant in photochemical applications. Safety data should be consulted for handling and potential toxicity, as quaternary ammonium compounds can pose risks in certain concentrations. Overall, this compound's unique structural features contribute to its diverse functional applications in chemistry and related fields.
Formula:C19H24ClNS
InChI:InChI=1/C19H23NS.ClH/c1-20(2)14-8-13-19(16-9-5-4-6-10-16)17-11-7-12-18(15-17)21-3;/h4-7,9-13,15H,8,14H2,1-3H3;1H/b19-13+;
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.