CAS 897-46-1

Texasin

Description:

Texasin, with the CAS number 897-46-1, is a chemical compound that belongs to the class of organic compounds known as phenols. It is characterized by its aromatic structure, which typically includes a hydroxyl group (-OH) attached to a benzene ring. Texasin is known for its potential applications in various fields, including pharmaceuticals and agrochemicals, due to its biological activity. The compound may exhibit properties such as antimicrobial or antifungal activity, making it of interest in medicinal chemistry. Additionally, its solubility and stability can vary depending on the solvent and environmental conditions. Safety data sheets and regulatory information should be consulted for handling and usage guidelines, as with any chemical substance. Overall, Texasin represents a notable example of how organic compounds can have diverse applications based on their structural characteristics and reactivity.

Formula: C₁₆H₁₂O₅

InChI: InChI=1S/C16H12O5/c1-20-10-4-2-9(3-5-10)12-8-21-15-7-14(18)13(17)6-11(15)16(12)19/h2-8,17-18H,1H3

InChI key: InChIKey=GCWOYVFHJDNKIN-UHFFFAOYSA-N

SMILES: O=C1C=2C(=CC(O)=C(O)C2)OC=C1C3=CC=C(OC)C=C3

Synonyms:

• 4H-1-Benzopyran-4-one, 6,7-dihydroxy-3-(4-methoxyphenyl)-
• 6,7-Dihydroxy-3-(4-methoxyphenyl)-4H-1-benzopyran-4-one
• 6,7-Dihydroxy-4′-methoxyisoflavone
• 6,7-dihydroxy-3-(4-methoxyphenyl)-4H-chromen-4-one
• Isoflavone, 6,7-dihydroxy-4′-methoxy-
• Texasin
• 6,7-Dihydroxy-3-(4-methoxyphenyl)-4-benzopyrone

Astragalus Metabolite 3 (Texasin)

CAS: 897-46-1

Formula: C₁₆H₁₂O₅

Molecular weight: 284.27

Ref: 4Z-A-317003

6,7-Dihydroxy-4'-methoxyisoflavone

CAS: 897-46-1

6,7-Dihydroxy-4'-methoxyisoflavone is an isoflavonoid compound, which is a subclass of flavonoids. These compounds are naturally occurring and are primarily derived from plants, particularly legumes such as soybeans. Isoflavones are known for their structural similarity to estrogens and are often studied for their potential biological activity.

Formula: C₁₆H₁₂O₅

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 284.26 g/mol

Ref: 3D-FD137990

Texasin

CAS: 897-46-1

Texasin is a selective inhibitor of human leukocyte 5-lipoxygenase.

Formula: C₁₆H₁₂O₅

Purity: 98%

Color and Shape: Solid

Molecular weight: 284.26

Ref: TM-T24869