CAS 897008-37-6
:Ethyl 3,6-dimethyl-4-pyridazinecarboxylate
Description:
Ethyl 3,6-dimethyl-4-pyridazinecarboxylate is an organic compound characterized by its pyridazine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms. This compound features ethyl and dimethyl substituents, contributing to its unique chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the carboxylate functional group indicates that it can participate in various chemical reactions, such as esterification and nucleophilic substitutions. Ethyl 3,6-dimethyl-4-pyridazinecarboxylate may exhibit moderate solubility in organic solvents, while its solubility in water can vary. Its applications may include use in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, this compound represents a versatile building block in synthetic organic chemistry.
Formula:C9H12N2O2
InChI:InChI=1S/C9H12N2O2/c1-4-13-9(12)8-5-6(2)10-11-7(8)3/h5H,4H2,1-3H3
InChI key:InChIKey=IZRJQEVPEGZWRZ-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=C(C)N=NC(C)=C1
Synonyms:- 4-Pyridazinecarboxylic acid, 3,6-dimethyl-, ethyl ester
- Ethyl 3,6-dimethyl-4-pyridazinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
