CAS 89701-85-9: Biflorin

Description:Biflorin, with the CAS number 89701-85-9, is a naturally occurring chemical compound primarily derived from certain plant species, particularly those in the genus *Biflorus*. It is classified as a flavonoid, which is a type of polyphenolic compound known for its diverse biological activities. Biflorin exhibits antioxidant properties, which can help in neutralizing free radicals and reducing oxidative stress in biological systems. Additionally, it has been studied for its potential anti-inflammatory and antimicrobial effects, making it of interest in pharmacological research. The compound is typically characterized by its specific molecular structure, which includes multiple hydroxyl groups contributing to its reactivity and solubility in polar solvents. Biflorin's applications may extend to food, cosmetics, and medicinal formulations, where its beneficial properties can be harnessed. However, further research is necessary to fully understand its mechanisms of action and potential therapeutic uses.

Formula:C₁₆H₁₈O₉

InChI:InChI=1S/C16H18O9/c1-5-2-6(18)10-8(24-5)3-7(19)11(13(10)21)16-15(23)14(22)12(20)9(4-17)25-16/h2-3,9,12,14-17,19-23H,4H2,1H3/t9-,12-,14+,15-,16+/m1/s1

InChI key:InChIKey=XTZWWMZDVUKEDJ-SPEJKDPOSA-N

SMILES:O=C1C=C(OC2=CC(O)=C(C(O)=C12)C3OC(CO)C(O)C(O)C3O)C

Synonyms:
4H-1-Benzopyran-4-one, 6-β-<span class="text-smallcaps">D</span>-glucopyranosyl-5,7-dihydroxy-2-methyl-
6-β-<span class="text-smallcaps">D</span>-Glucopyranosyl-5,7-dihydroxy-2-methyl-4H-1-benzopyran-4-one
89701-85-9
Biflorin
Biflorin (Pancratinium)
α-Glucosidase inhibitor CB-2
4H-1-Benzopyran-4-one, 6-β-D-glucopyranosyl-5,7-dihydroxy-2-methyl-
6-β-D-Glucopyranosyl-5,7-dihydroxy-2-methyl-4H-1-benzopyran-4-one

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	Biflorin REF: 3D-FB65680CAS: 89701-85-9	Min. 95%	181.00 €~1,331.00 €	Thu 15 May 25
	Biflorin REF: TR-B215055CAS: 89701-85-9	- - -	1,621.00 €~9,038.00 €	Mon 16 Jun 25