CAS 897015-56-4
:N-[(3-Fluorophenyl)methyl]-[1,1'-biphenyl]-3-acetamide
Description:
N-[(3-Fluorophenyl)methyl]-[1,1'-biphenyl]-3-acetamide, with the CAS number 897015-56-4, is a chemical compound characterized by its biphenyl structure substituted with a fluorophenyl group and an acetamide functional group. This compound typically exhibits properties associated with both aromatic and amide functionalities, which can influence its solubility, stability, and reactivity. The presence of the fluorine atom may enhance lipophilicity and alter the electronic properties of the molecule, potentially affecting its biological activity. As an amide, it may participate in hydrogen bonding, influencing its interactions in biological systems or chemical reactions. The compound's structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where modifications to the biphenyl and acetamide moieties can lead to variations in pharmacological properties. Overall, the characteristics of this compound make it a subject of interest for further research in various chemical and biological contexts.
Formula:C21H18FNO
InChI:InChI=1/C21H18FNO/c22-20-11-5-7-17(13-20)15-23-21(24)14-16-6-4-10-19(12-16)18-8-2-1-3-9-18/h1-13H,14-15H2,(H,23,24)
SMILES:c1ccc(cc1)c1cccc(c1)CC(=NCc1cccc(c1)F)O
Synonyms:- [1,1'-biphenyl]-3-acetamide, N-[(3-fluorophenyl)methyl]-
- 2-(Biphenyl-3-yl)-N-(3-fluorobenzyl)acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.