CymitQuimica logo

CAS 897017-00-4

:

4-[2-[3-Fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethyl]morpholine

Description:
4-[2-[3-Fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethyl]morpholine, with CAS number 897017-00-4, is a synthetic organic compound characterized by its complex molecular structure, which includes a morpholine ring and a boron-containing moiety. The presence of the fluorine atom suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as fluorinated compounds often exhibit enhanced metabolic stability and bioactivity. The dioxaborolane group is notable for its ability to participate in various chemical reactions, including Suzuki coupling, making this compound potentially useful in organic synthesis. Additionally, the phenoxy and ethyl linkages contribute to its solubility and reactivity profiles. Overall, this compound exemplifies the integration of diverse functional groups, which can influence its physical and chemical properties, such as polarity, reactivity, and potential biological activity. Its specific applications would depend on further studies, including its efficacy and safety in biological systems.
Formula:C18H27BFNO4
InChI:InChI=1S/C18H27BFNO4/c1-17(2)18(3,4)25-19(24-17)15-6-5-14(13-16(15)20)23-12-9-21-7-10-22-11-8-21/h5-6,13H,7-12H2,1-4H3
InChI key:InChIKey=XMZJWQLMKORRSN-UHFFFAOYSA-N
SMILES:FC1=C(B2OC(C)(C)C(C)(C)O2)C=CC(OCCN3CCOCC3)=C1
Synonyms:
  • 4-[2-[3-Fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethyl]morpholine
  • 4-[2-[4-(4,4,5,5-Tetramethyl-1,3-dioxolan-2-yl)phenoxy]ethyl]morpholine
  • Morpholine, 4-[2-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.