CymitQuimica logo

CAS 897030-99-8

:

4-chloro-5-iodo-6-methylpyrimidin-2-amine

Description:
4-Chloro-5-iodo-6-methylpyrimidin-2-amine is a heterocyclic organic compound characterized by its pyrimidine ring structure, which is a six-membered ring containing two nitrogen atoms at positions 1 and 3. This compound features a chlorine atom at the 4-position, an iodine atom at the 5-position, and a methyl group at the 6-position, along with an amino group at the 2-position. These substituents contribute to its unique chemical properties, including potential reactivity and solubility characteristics. The presence of halogens (chlorine and iodine) can influence its biological activity and interactions with other molecules, making it of interest in medicinal chemistry and drug development. The compound may exhibit various functional properties, such as being a potential building block for pharmaceuticals or agrochemicals. Its molecular structure suggests it could participate in nucleophilic substitution reactions or serve as a ligand in coordination chemistry. As with many pyrimidine derivatives, it may also exhibit interesting pharmacological activities, warranting further investigation in biological systems.
Formula:C5H5ClIN3
InChI:InChI=1/C5H5ClIN3/c1-2-3(7)4(6)10-5(8)9-2/h1H3,(H2,8,9,10)
InChI key:FLHZBTLBILVJOJ-UHFFFAOYSA-N
SMILES:Cc1c(c(Cl)nc(=N)[nH]1)I
Synonyms:
  • 2-Pyrimidinamine, 4-Chloro-5-Iodo-6-Methyl-
  • Chloro-5-iodo-6-methylpyrimidin-2-amine, 4-
  • 4-Chloro-5-iodo-6-methylpyrimidin-2-amine
Found 4 products.