CAS 89704-51-8
:2-methoxy-5-(pyrrolidin-1-ylsulfonyl)benzoate
Description:
2-Methoxy-5-(pyrrolidin-1-ylsulfonyl)benzoate, with the CAS number 89704-51-8, is a chemical compound that features a benzoate structure substituted with a methoxy group and a pyrrolidinylsulfonyl moiety. This compound is characterized by its aromatic ring, which contributes to its stability and potential reactivity. The presence of the methoxy group enhances its solubility in organic solvents and may influence its biological activity. The pyrrolidinylsulfonyl group introduces a sulfonyl functional group, which can enhance the compound's interaction with biological targets, potentially making it useful in medicinal chemistry. The sulfonyl group is known for its ability to participate in various chemical reactions, including nucleophilic substitutions. Overall, this compound may exhibit interesting pharmacological properties, making it a subject of interest in drug development and research. Its specific characteristics, such as melting point, boiling point, and solubility, would require empirical measurement or literature reference for precise values.
Formula:C12H14NO5S
InChI:InChI=1/C12H15NO5S/c1-18-11-5-4-9(8-10(11)12(14)15)19(16,17)13-6-2-3-7-13/h4-5,8H,2-3,6-7H2,1H3,(H,14,15)/p-1
SMILES:COc1ccc(cc1C(=O)[O-])S(=O)(=O)N1CCCC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

